| Name | sec-butylurea |
| Synonyms | Nsc27458 sec-butylurea 1-sec-Butylurea N-sec-Butylurea Urea, sec-butyl- 1-butan-2-ylurea N-(SEC-BUTYL)UREA secondarybutylurea 2-METHYLPROPYLUREA [(2R)-butan-2-yl]urea N-(1-METHYLPROPYL)UREA 1-[(2R)-butan-2-yl]urea 1-[(2S)-butan-2-yl]urea Urea, (1-methylpropyl)- |
| CAS | 689-11-2 |
| EINECS | 211-709-1 |
| InChI | InChI=1/C5H12N2O/c1-3-4(2)7-5(6)8/h4H,3H2,1-2H3,(H3,6,7,8)/t4-/m1/s1 |
| Molecular Formula | C5H12N2O |
| Molar Mass | 116.16 |
| Density | 1.0551 (rough estimate) |
| Melting Point | 165-166 °C |
| Boling Point | 217.23°C (rough estimate) |
| Flash Point | 57.5°C |
| Vapor Presure | 1.4mmHg at 25°C |
| Appearance | White solid |
| pKa | 14.40±0.46(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.4496 (estimate) |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| category | toxic substances |
| toxicity grade | low toxicity |
| Acute toxicity | oral-rat LD50: 7500 mg/kg |
| flammability hazard characteristics | toxic NOx emission from thermal decomposition |
| storage and transportation characteristics | warehouse ventilation and low temperature drying |
| fire extinguishing agent | water, dry powder, carbon dioxide, foam |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |