| Name | gamma-oxo-1-pyrenebutyric acid |
| Synonyms | LABOTEST-BB LT00112354 γ-oxo-1-pyrenebutyric acid γ-Oxopyrene-1-butyric acid γ-Oxopyrene-1-butanoic acid gamma-oxo-1-pyrenebutyric acid GAMMA-OXO-1-PYRENEBUTYRIC ACID gamma-oxopyrene-1-butyric acid gamma-Oxopyrene-1-butyric acid 4-OXO-4-PYREN-1-YL-BUTYRIC ACID 4-Oxo-4-pyren-1-yl-butyric acid 4-oxo-4-(pyren-1-yl)butanoic acid GAMMA-OXO-1-PYRENEBUTYRIC ACID, TECH. |
| CAS | 7499-60-7 |
| EINECS | 231-354-6 |
| InChI | InChI=1/C20H14O3/c21-17(10-11-18(22)23)15-8-6-14-5-4-12-2-1-3-13-7-9-16(15)20(14)19(12)13/h1-9H,10-11H2,(H,22,23) |
| Molecular Formula | C20H14O3 |
| Molar Mass | 302.32 |
| Density | 1.2559 (rough estimate) |
| Melting Point | 184°C (dec.)(lit.) |
| Boling Point | 383.36°C (rough estimate) |
| Flash Point | 315.1°C |
| Vapor Presure | 5.04E-14mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.4618 (estimate) |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |