| Name | 5-Fluoro-2-methylbenzonitrile |
| Synonyms | 5-Fluoro-2-methylben Cerium(3+) trifluoride 2-cyano-4-fluorotoluene 2-methyl-5-fluorobenzonitrile 5-Fluoro-2-methylbenzonitrile Benzonitrile, 5-fluoro-2-methyl- (9CI) 2-Cyano-4-fluorotoluene, 5-Fluoro-o-tolunitrile |
| CAS | 77532-79-7 |
| EINECS | 231-841-3 |
| InChI | InChI=1/C8H6FN/c1-6-2-3-8(9)4-7(6)5-10/h2-4H,1H3 |
| Molecular Formula | C8H6FN |
| Molar Mass | 135.14 |
| Density | 1.1203 (estimate) |
| Melting Point | 43-45 °C (lit.) |
| Boling Point | 230°C (rough estimate) |
| Flash Point | 175°F |
| Vapor Presure | 0.273mmHg at 25°C |
| Appearance | Yellow crystal |
| BRN | 7700578 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.507 |
| MDL | MFCD00042295 |
| Risk Codes | R37/38 - Irritating to respiratory system and skin. R41 - Risk of serious damage to eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S39 - Wear eye / face protection. |
| UN IDs | 3276 |
| WGK Germany | 3 |
| HS Code | 29269090 |
| Hazard Note | Toxic |
| Hazard Class | 6.1 |
| Packing Group | III |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |