| Name | 8-hydroxyquinoline-2-carboxaldehyde |
| Synonyms | AKOS BBS-00000128 8-Hydroxy-2-quinolinecarbaldehyde 8-hydroxyquinoline-2-carbaldehyde 8-HYDROXY-QUINOLINE-2-CARBALDEHYDE 8-HYDROXYQUINOLINE-2-CARBOXALDEHYDE 8-hydroxyquinoline-2-carboxaldehyde 8-Hydroxy-2-quinolinecarboxaldehyde |
| CAS | 14510-06-6 |
| InChI | InChI=1/C10H7NO2/c12-6-8-5-4-7-2-1-3-9(13)10(7)11-8/h1-6,13H |
| InChIKey | SLBPIHCMXPQAIQ-UHFFFAOYSA-N |
| Molecular Formula | C10H7NO2 |
| Molar Mass | 173.17 |
| Density | 1.364±0.06 g/cm3(Predicted) |
| Melting Point | 97-100 °C |
| Boling Point | 392.2±22.0 °C(Predicted) |
| Flash Point | 191°C |
| Vapor Presure | 1.03E-06mmHg at 25°C |
| Appearance | Yellow crystalline powder |
| Color | Yellow |
| BRN | 127519 |
| pKa | 9.27±0.10(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Sensitive | Sensitive to air |
| Refractive Index | 1.733 |
| MDL | MFCD00168962 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29339900 |
| use | 8-hydroxyquinoline-2-formaldehyde is a useful research chemical. Structural unit of synthetic complexing agent. |