| Name | Z-D-threonine |
| Synonyms | Z-D-Thr-OH Z-D-THR-OH Z-D-threonine Cbz-D-threonine N-Cbz-D-threonine N-CBZ-D-THREONINE Z-D-THREONINE extrapure N-CARBOBENZOXY-D-THREONINE N-Cbz-D-threonine Z-D-Thr-OH N-Benzyloxycarbonyl-D-threonine~Z-D-Thr-OH (2R)-2-benzyloxycarbonylamino-3-hydroxy-butanoic acid (2R,3S)-2-(benzyloxycarbonylamino)-3-hydroxybutanoic acid |
| CAS | 80384-27-6 |
| InChI | InChI=1/C12H15NO5/c1-8(14)10(11(15)16)13-12(17)18-7-9-5-3-2-4-6-9/h2-6,8,10,14H,7H2,1H3,(H,13,17)(H,15,16)/t8?,10-/m1/s1 |
| Molecular Formula | C12H15NO5 |
| Molar Mass | 253.25 |
| Density | 1.309±0.06 g/cm3(Predicted) |
| Melting Point | 100-102°C |
| Boling Point | 483.7±45.0 °C(Predicted) |
| Flash Point | 246.3°C |
| Vapor Presure | 3.62E-10mmHg at 25°C |
| BRN | 4695777 |
| pKa | 3.58±0.10(Predicted) |
| Storage Condition | Sealed in dry,2-8°C |
| Refractive Index | 5 ° (C=2, AcOH) |
| MDL | MFCD00037808 |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29241990 |