| Name | diisopentyl succinate |
| Synonyms | AI3-01975 Diisoamyl succinate diisopentyl succinate Diisopentyl succinate Di(2-methylbutyl) succinate succinic acid diisoamyl ester bis(3-methylbutyl) butanedioate Succinic acid diisopentyl ester Butanedioic acid, bis(3-methylbutyl) ester |
| CAS | 818-04-2 |
| EINECS | 212-448-6 |
| InChI | InChI=1/C14H26O4/c1-11(2)7-9-17-13(15)5-6-14(16)18-10-8-12(3)4/h11-12H,5-10H2,1-4H3 |
| Molecular Formula | C14H26O4 |
| Molar Mass | 258.35 |
| Density | 0.966g/cm3 |
| Boling Point | 281.1°C at 760 mmHg |
| Flash Point | 122.6°C |
| Vapor Presure | 0.00364mmHg at 25°C |
| Refractive Index | 1.439 |
| Use | Used in the manufacture of spices, synthetic resins, plastics and additives, and also used in gas chromatography stationary liquid |
| Use | for the manufacture of fragrances, synthetic resins, plastics and additives, also used for gas chromatography stationary liquid |