| Name | 4-Benzyloxyphenylacetonitrile |
| Synonyms | 4-BENZYLOXYBENZYL CYANIDE 4-Benzyloxybenzyl cyanide 4-BENZYLOXYPHENYLACETONITRILE 4-Benzyloxyphenylacetonitrile Para Benzyloxy Phenyl Acetonitrile 2-[4-(benzyloxy)phenyl]acetonitrile Benzeneacetonitrile, 4-(phenylmethoxy)- |
| CAS | 838-96-0 |
| EINECS | 617-499-1 |
| InChI | InChI=1/C15H13NO/c16-11-10-13-6-8-15(9-7-13)17-12-14-4-2-1-3-5-14/h1-9H,10,12H2 |
| Molecular Formula | C15H13NO |
| Molar Mass | 223.27 |
| Density | 1.114g/cm3 |
| Melting Point | 65 °C |
| Boling Point | 170-173°C 0,1mm |
| Flash Point | 170-173°C/0.1mm |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Vapor Presure | 3.29E-06mmHg at 25°C |
| Appearance | Powder |
| Color | Cream |
| Maximum wavelength(λmax) | ['284nm(EtOH aq.)(lit.)'] |
| BRN | 2377584 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.582 |
| MDL | MFCD00016400 |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S36 - Wear suitable protective clothing. S36/37 - Wear suitable protective clothing and gloves. |
| UN IDs | 3439 |
| HS Code | 29269090 |
| Hazard Class | 6.1 |
| Packing Group | III |