| Name | 2-Chloro-5-methoxyaniline hydrochloride |
| Synonyms | TIMTEC-BB SBB008038 6-CHLORO-M-ANISIDINE.HCL 6-CHLORO-M-ANISIDINE HYDROCHLORIDE 6-Chloro-m-anisidine hydrochloride 2-chloro-5-methoxyanilinium chloride 4-CHLORO-3-AMINOANISOLE HYDROCHLORIDE 2-CHLORO-5-METHOXYANILINE HYDROCHLORIDE 2-Chloro-5-methoxyaniline hydrochloride (6-chloro-3-methoxy-1-cyclohexa-2,4-dienylidene)ammonium chloride |
| CAS | 85006-21-9 |
| EINECS | 285-050-3 |
| InChI | InChI=1/C7H8ClNO.ClH/c1-10-5-2-3-6(8)7(9)4-5;/h2-4H,9H2,1H3;1H |
| Molecular Formula | C7H9Cl2NO |
| Molar Mass | 194.06 |
| Melting Point | 207°C (dec.)(lit.) |
| Appearance | White to yellow powder |
| BRN | 3699386 |
| Storage Condition | Room Temprature |
| MDL | MFCD00012962 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection S36/37 - Wear suitable protective clothing and gloves. |
| UN IDs | 2811 |
| WGK Germany | 3 |
| HS Code | 29222900 |
| Hazard Note | Irritant |
| Hazard Class | 6.1 |
| Packing Group | III |