| Name | 2-Bromo-4,5-difluorotoluene |
| Synonyms | 2-Bromo-4,5-difluorotoluene 2-BROMO-4,5-DIFLUOROTOLUENE 4,5-DIFLUORO-2-METHYLBROMOBENZENE 1-Bromo-4,5-difluoro-2-methylbenzene 1-BROMO-4,5-DIFLUORO-2-METHYLBENZENE 1-BROMO-4,5-DIFLUORO-2-METHYL-BENZENE 1-brommo-4,5-difluoro-2-methyl-benzene Benzene, 1-bromo-4,5-difluoro-2-methyl- |
| CAS | 875664-38-3 |
| InChI | InChI=1/C7H5BrF2/c1-4-2-6(9)7(10)3-5(4)8/h2-3H,1H3 |
| InChIKey | FKEURBCLFHOBDM-UHFFFAOYSA-N |
| Molecular Formula | C7H5BrF2 |
| Molar Mass | 207.02 |
| Density | 1.588g/cm3 |
| Boling Point | 183.5°C at 760 mmHg |
| Flash Point | 64.8°C |
| Vapor Presure | 1.05mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.508 |
| MDL | MFCD07777160 |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |