| Name | pentafluoronitrobenzene |
| Synonyms | PENTAFLUORONITROBENZ PENTAFLUORONITROBENZENE Pentafluoronitrobenzene pentafluoronitrobenzene 1-Nitropentafluorobenzene pentaflurophenylacetic acid 1,2,3,4,5-pentafluoro-6-nitrobenzene 2,3,4,5,6-Pentafluoro-1-nitrobenzene 1-Nitro-2,3,4,5,6-pentafluorobenzene, Perfluoronitrobenzene |
| CAS | 880-78-4 |
| EINECS | 212-915-4 |
| InChI | InChI=1/C6F5NO2/c7-1-2(8)4(10)6(12(13)14)5(11)3(1)9 |
| Molecular Formula | C6F5NO2 |
| Molar Mass | 213.06 |
| Density | 1.656g/mLat 25°C(lit.) |
| Melting Point | -22.65°C |
| Boling Point | 158-161°C(lit.) |
| Flash Point | 195°F |
| Vapor Presure | 3.24mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.447(lit.) |
| Physical and Chemical Properties | Boiling point 158 ℃-161 ℃, flash point 90 ℃, refractive index 1.4470, specific gravity 1.061. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| HS Code | 29049090 |
| Hazard Note | Irritant |
| chemical properties | boiling point 158 ℃-161 ℃, flash point 90 ℃, refractive index 1.4470, specific gravity 1.061. |
| uses | intermediates in medicine, pesticides and liquid crystal materials. |