| Name | (5-amino-2-chlorophenyl)methanol |
| Synonyms | 5-AMINO-2-CHLOROBENYL 5-AMINO-2-CHLOROBENYL ALCOHOL 5-Amino-2-chlorobenzyl alcohol 2-Chloro-5-aminobenzyl alcohol 2-Chloro-5-aminobenzenemethanol (5-amino-2-chlorophenyl)methanol 4-Chloro-3-(hydroxymethyl)aniline |
| CAS | 89951-56-4 |
| EINECS | 604-604-1 |
| InChI | InChI=1/C7H8ClNO/c8-7-2-1-6(9)3-5(7)4-10/h1-3,10H,4,9H2 |
| Molecular Formula | C7H8ClNO |
| Molar Mass | 157.6 |
| Density | 1.341g/cm3 |
| Melting Point | 119-123 °C (lit.) |
| Boling Point | 326°C at 760 mmHg |
| Flash Point | 151°C |
| Vapor Presure | 9.03E-05mmHg at 25°C |
| Refractive Index | 1.63 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |