| Name | 9-Anthracenecarbonitrile |
| Synonyms | AKOS B004035 9-Anthronitrile 9-CYANOANTHRACENE 9-Cyanoanthracene LABOTEST-BB LT00159449 9-Anthracenecarbonitrile 9-ANTHRACENECARBONITRILE anthracene-9-carbonitrile 9-Anthrracenecarbonitrile 9-Anthracen-Carboxylic Acid |
| CAS | 1210-12-4 |
| EINECS | 214-909-7 |
| InChI | InChI=1/C15H9N/c16-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1-9H |
| Molecular Formula | C15H9N |
| Molar Mass | 203.24 |
| Density | 1.20±0.1 g/cm3(Predicted) |
| Melting Point | 173-177°C(lit.) |
| Boling Point | 413.8±14.0 °C(Predicted) |
| Flash Point | 205.4°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 4.67E-07mmHg at 25°C |
| Appearance | White solid |
| BRN | 1911437 |
| Storage Condition | Room Temprature |
| Refractive Index | 1.719 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | 36 - Wear suitable protective clothing. |
| UN IDs | 3276 |
| WGK Germany | 3 |
| TSCA | Yes |
| Hazard Class | 6.1 |
| Packing Group | III |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |