| Name | 9-Anthraldehyde |
| Synonyms | A-9-A AKOS B029849 9-Anthraldehyde 9-ANTHRALDEHYDE AKOS BBS-00003154 9-Anthrylaldehyde 9-Formylanthracene 9-Anthrylcarboxaldehyde 9-ANTHRACENECARBALDEHYDE 9-Anthracenecarbaldehyde anthracene-9-carbaldehyde 9-ANTHRACENECARBOXALDEHYDE 9-Anthracenecarboxaldehyde Anthracene-9-Carboxaldehyde |
| CAS | 642-31-9 |
| EINECS | 211-383-0 |
| InChI | InChI=1/C15H10O/c16-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1-10H |
| InChIKey | YMNKUHIVVMFOFO-UHFFFAOYSA-N |
| Molecular Formula | C15H10O |
| Molar Mass | 206.24 |
| Density | 1.0701 (rough estimate) |
| Melting Point | 103-105 °C (lit.) |
| Boling Point | 305.09°C (rough estimate) |
| Flash Point | 269.2°C |
| Solubility | Soluble in toluene. |
| Vapor Presure | 8.58E-07mmHg at 25°C |
| Appearance | Yellow crystalline powder |
| Color | Yellow |
| BRN | 639167 |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Stability | Stable. Incompatible with strong bases, strong oxidizing agents. |
| Sensitive | Air Sensitive |
| Refractive Index | 1.6324 (estimate) |
| MDL | MFCD00001254 |
| Physical and Chemical Properties | Yellow crystals. Melting point 104-105 °c. |
| Use | Used as a dye, pharmaceutical and other intermediates |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29122900 |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | Product intermediates such as dyes and pharmaceuticals. used as dye, medicine and other intermediates |
| production method | raw materials: yellow phosphorus, liquid chlorine. |