| Name | 2-Bromo-5-nitrobenzoic acid |
| Synonyms | TIMTEC-BB SBB003179 2-bromo-5-nitrobenzoate 2-Bromo-5-nitrobenzic acid 2-Bromo-5-nitrobenzoic acid 2-BROMO-5-NITROBENZOIC ACID 2-broMo-5-nitrobencoic acid benzoic acid, 2-bromo-5-nitro- Benzoic acid, 2-bromo-5-nitro- |
| CAS | 943-14-6 |
| EINECS | 619-009-1 |
| InChI | InChI=1/C7H4BrNO4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,(H,10,11)/p-1 |
| InChIKey | UVFWYVCDRKRAJH-UHFFFAOYSA-N |
| Molecular Formula | C7H4BrNO4 |
| Molar Mass | 246.01 |
| Density | 2.0176 (rough estimate) |
| Melting Point | 180-181 °C (lit.) |
| Boling Point | 370.5±32.0 °C(Predicted) |
| Flash Point | 177.8°C |
| Solubility | Chloroform, Methanol |
| Vapor Presure | 3.83E-06mmHg at 25°C |
| Appearance | Powder |
| Color | Light beige to pale brown |
| BRN | 980242 |
| pKa | 2.15±0.10(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.6200 (estimate) |
| MDL | MFCD00134558 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29163990 |