| Name | (benzothiazol-2-ylthio)succinic acid |
| Synonyms | IRGACOR 252 FC IRGACOR 252 LD (2-BENZOTHIAZOYLTHIO) SUCCINIC ACID (2-Benzothiazolylthio)-succinic acid (benzothiazol-2-ylthio)succinic acid 1-(benzothiaxole-2-ylthio)succnic acid (2-BENZOTHIAZOLYLTHIO) BUTANEDIOIC ACID Butanedioic acid, (2-benzothiazolylthio)- 2-(1,3-BENZOTHIAZOL-2-YLTHIO)SUCCINIC ACID 2-(1,3-Benzothiazol-2-ylthio)succinic acid Butanedioic acid, 2-(2-benzothiazolylthio)- (2-BENZOTHIAZOLYLTHIO) BUTANEDIOIC ACID, WATER 2-(1,3-benzothiazol-2-ylsulfanyl)butanedioic acid (2R)-2-[(2R)-2-sulfanyl-2,3-dihydro-1,3-benzothiazol-5-yl]butanedioic acid |
| CAS | 95154-01-1 |
| EINECS | 401-450-4 |
| InChI | InChI=1/C11H11NO4S2/c13-9(14)4-6(10(15)16)5-1-2-8-7(3-5)12-11(17)18-8/h1-3,6,11-12,17H,4H2,(H,13,14)(H,15,16)/t6-,11-/m1/s1 |
| Molecular Formula | C11H9NO4S2 |
| Molar Mass | 283.32 |
| Density | 1.60±0.1 g/cm3(Predicted) |
| Boling Point | 456.6±55.0 °C(Predicted) |
| Flash Point | 242.8°C |
| Water Solubility | 180g/L at 20℃ |
| Solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| Vapor Presure | 0Pa at 20℃ |
| Appearance | Solid |
| Color | White to Off-White |
| pKa | 3.10±0.23(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.718 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 43 - May cause sensitization by skin contact |
| Safety Description | S24 - Avoid contact with skin. S37 - Wear suitable gloves. |
| LogP | -2.93 at 20℃ |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |