| Name | cis-vinylenebis[diphenylphosphine] |
| Synonyms | cis-vinylenebis[diphenylphosphine] cis-Vinylenebis(diphenylphosphine) (Z)-1,2-Bis(diphenylphosphino)ethene ethene-1,2-diylbis(diphenylphosphane) Cis-1,2-Bis(Diphenylphosphino)Ethylene CIS-1,2-BIS(DIPHENYLPHOSPHINO)ETHYLENE (Z)-1,2-Ethenediylbis(diphenylphosphine) (E)-ethene-1,2-diylbis(diphenylphosphane) (Z)-ethene-1,2-diylbis(diphenylphosphane) [(Z)-1,2-Ethenediyl]bis(diphenylphosphine) [(Z)-Ethene-1,2-diyl]bis(diphenylphosphine) |
| CAS | 983-80-2 |
| EINECS | 213-569-7 |
| InChI | InChI=1/C26H22P2/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-22H/b22-21- |
| Molecular Formula | C26H22P2 |
| Molar Mass | 396.4 |
| Melting Point | 122-124°C(lit.) |
| Boling Point | 546.8±33.0 °C(Predicted) |
| Flash Point | 302.7°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 1.87E-11mmHg at 25°C |
| Appearance | crystal |
| Color | white |
| BRN | 757792 |
| Storage Condition | 2-8℃ |
| Sensitive | Air Sensitive |
| MDL | MFCD00003046 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| HS Code | 29310099 |