| Name | ACETOPHENONE-D8 |
| Synonyms | ACETOPHENONE-D8 Acetophenone-d8 1-(~2~H_5_)phenyl(~2~H_3_)ethanone 1-(Phenyl-2,3,4,5,6-d5)-ethanone-2,2,2-d3 |
| CAS | 19547-00-3 |
| InChI | InChI=1/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3/i1D3,2D,3D,4D,5D,6D |
| Molecular Formula | C8D8O |
| Molar Mass | 128.2 |
| Density | 1.098g/mLat 25°C |
| Melting Point | 19-20°C(lit.) |
| Boling Point | 202°C(lit.) |
| Flash Point | 180°F |
| Vapor Presure | 0.299mmHg at 25°C |
| Storage Condition | Room Temprature |
| Refractive Index | n20/D 1.5322(lit.) |
| Physical and Chemical Properties | WGK Germany:3 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R36 - Irritating to the eyes |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| UN IDs | UN 3334 |
| WGK Germany | 3 |
| HS Code | 28459000 |
| Use | Deuterated acetophenone is a deuterated reagent, which can be prepared from benzo-d6 in two steps. |