| Name | 2,3-dichloromaleic anhydride |
| Synonyms | oromaL NSC 60524 AI3-26596 DICHLOROMALEIC ANHYDRIDE Dichloromaleic anhydride 3,4-dichloro-5-furandione 3,4-Dichloro-2,5-furandione 3,4-dichlorofuran-2,5-dione 2,3-DICHLOROMALEIC ANHYDRIDE 2,3-dichloromaleic anhydride 2,5-Furandione, 3,4-dichloro- Dichloromaleic acid anhydride 3,4-dichlorofuran-2,5-quinone 2,3-Dichloromaleic acid anhydride Maleic anhydride, dichloro- (8CI) |
| CAS | 1122-17-4 |
| EINECS | 214-343-0 |
| InChI | InChI=1/C4Cl2O3/c5-1-2(6)4(8)9-3(1)7 |
| InChIKey | AGULWIQIYWWFBJ-UHFFFAOYSA-N |
| Molecular Formula | C4Cl2O3 |
| Molar Mass | 166.95 |
| Density | 1.7168 (estimate) |
| Melting Point | ~120°C |
| Boling Point | 118-125 °C |
| Flash Point | 74.1°C |
| Solubility | Chloroform, Methanol (Slightly, Heated) |
| Vapor Presure | 1.46mmHg at 25°C |
| Appearance | Powder |
| Color | White |
| BRN | 121027 |
| Storage Condition | Inert atmosphere,2-8°C |
| Sensitive | Easily absorbing moisture |
| Refractive Index | 1.548 |
| MDL | MFCD00005520 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-21 |
| Hazard Class | IRRITANT |
| EPA chemical information | 2,5-Furandione, 3,4-dibromo- (1122-12-9) |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |