| Name | Ac-Trp-OH |
| Synonyms | Ac-Trp-Oh AC-TRP-OH Ac-Trp-OH AC-TRYPTOPHAN N-Ac-Tryptohan N-acetyltryptophan ACETYL-L-TRYPTOPHAN ACETYL-L-TRYPTOPHANE N-ACETYL-L-TRYPTOPHAN N-α-Acetyl-L-Tryptophan Tryptophan Related CoMpound B L-N-ACETYL-2-AMINO-3-(3-INDOLYL)PROPIONIC ACID (S)-2-acetaMido-3-(1H-indol-3-yl)propanoic acid |
| CAS | 1218-34-4 |
| EINECS | 214-935-9 |
| InChI | InChI=1/C13H14N2O3/c1-8(16)15-12(13(17)18)6-9-7-14-11-5-3-2-4-10(9)11/h2-5,7,12,14H,6H2,1H3,(H,15,16)(H,17,18)/t12-/m0/s1 |
| Molecular Formula | C13H14N2O3 |
| Molar Mass | 246.26 |
| Density | 1.1855 (rough estimate) |
| Melting Point | 186°C |
| Boling Point | 389.26°C (rough estimate) |
| Specific Rotation(α) | +24.0~+30.0°(20℃/D)(c=1,C2H5OH) |
| Flash Point | 308.6°C |
| Vapor Presure | 1.32E-14mmHg at 25°C |
| Appearance | White powder |
| Color | White to Off-white |
| pKa | 3.65±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Refractive Index | 1.6450 (estimate) |
| MDL | MFCD00065976 |
| WGK Germany | 2 |
| RTECS | YN6160000 |
| TSCA | Yes |
| HS Code | 29339900 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | N-acetyl-L-tryptophan is widely used in pharmaceutical and chemical industry, biochemical industry, electronic crystal and other industries. |
| biological activity | N-Acetyl-L-tryptophan is an endogenous metabolite. |
| category | toxic substances |
| toxicity classification | low toxicity |
| acute toxicity | oral-rat LD50:15000 mg/kg; Oral-mouse LD50: 10800 mg/kg |
| flammability hazard characteristics | flammability; heating decomposition releases toxic nitrogen oxide smoke |
| storage and transportation characteristics | warehouse ventilation and low temperature drying |
| fire extinguishing agent | dry powder, foam, sand, carbon dioxide, mist water |