| Name | Acetoxybenzaldehyde |
| Synonyms | Acetoxybenzaldehyde 3-FORMYLPHENYLACETATE 3-ACETOXYBENZALDEHYDE 3-Acetoxybenzaldehyde 3-Formylphenyl acetate M-FORMYL PHENYL ACETATE 3-(acetyloxy)Benzaldehyde ACETIC ACID 3-FORMYL-PHENYL ESTER 3-Formylphenyl Acetate Acetic Acid 3-Formylphenyl Ester 3-Acetoxybenzaldehyde, Acetic acid 3-formylphenyl ester |
| CAS | 34231-78-2 |
| EINECS | 251-890-4 |
| InChI | InChI=1/C9H8O3/c1-7(11)12-9-4-2-3-8(5-9)6-10/h2-6H,1H3 |
| Molecular Formula | C9H8O3 |
| Molar Mass | 164.16 |
| Density | 1,17 g/cm3 |
| Boling Point | 138°C 20mm |
| Flash Point | 138°C/20mm |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 0.00637mmHg at 25°C |
| BRN | 1941499 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Sensitive | Air Sensitive |
| Refractive Index | 1.5330 |
| MDL | MFCD00016603 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| HS Code | 29130000 |
| Hazard Class | IRRITANT |
| Use | 3-acetoxybenzaldehyde is a useful research chemical. An intermediate for the preparation of a functionally substituted benzaldehyde. |