| Name | Acipimox |
| Synonyms | K-9321 Olbemox Olbetam Acipimox 5-Carboxy-2-methylpyrazine 1-oxide 4-oxo-5-methylpyrazine-2-carboxylic acid 4-Oxide-5-Methylpyrazine-2-CarboxylicAcid 4-Oxo-5-Methyl-2-Pyrazine-carboxylic Acid 5-methylpyrazine-2-carboxylic acid 4-oxide 5-methyl-4-oxido-2-pyrazin-4-iumcarboxylic acid 2-Carboxy-5-methylpyrazine 4-oxide, 5-Methylpyrazinecarboxylic acid 4-oxide |
| CAS | 51037-30-0 |
| EINECS | 256-928-3 |
| InChI | InChI=1/C6H6N2O3/c1-4-2-7-5(6(9)10)3-8(4)11/h2-3H,1H3,(H,9,10) |
| InChIKey | DJQOOSBJCLSSEY-UHFFFAOYSA-N |
| Molecular Formula | C6H6N2O3 |
| Molar Mass | 154.12 |
| Density | 1.44±0.1 g/cm3(Predicted) |
| Melting Point | 177-180°C |
| Boling Point | 539.0±45.0 °C(Predicted) |
| Flash Point | 279.8°C |
| Solubility | Soluble in methanol, water (100 mM), DMSO (100 mM), ethanol (<1 mg/ml at 25° C), and 1 M NH4OH (1 mg/ml). |
| Vapor Presure | 1.88E-12mmHg at 25°C |
| Appearance | Solid |
| Color | Yellow |
| Merck | 14,111 |
| pKa | 2.80±0.10(Predicted) |
| Storage Condition | Inert atmosphere,2-8°C |
| Refractive Index | 1.608 |
| Physical and Chemical Properties | Crystallized from water, melting point 177-180 ℃. Acute toxic LD50 mice (mg/kg):3500 oral. |
| Use | This product is for scientific research only and shall not be used for other purposes. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36 - Irritating to the eyes |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| RTECS | UQ2453000 |
| Toxicity | LD50 orally in mice: 3500 mg/kg (Ambrogi) |