| Name | Adapalene |
| Synonyms | CD-271 Differi Adapalen ADAPALENE Adapalene 6-[3-(1-ADAMANTYL)-4-METHOXYPHENYL]-2-NAPHTHOIC ACID 6-[3-(1-ADAMANTYL)-4-METHOXYPHENYL]-2-NAPHTHALENE CARBOXYLIC ACID 6-[3-(1-adamantyl)-4-methoxy-phenyl]naphthalene-2-carboxylic acid 6-[3-(1-Adamantyl)-4-methoxy-phenyl]naphthalene-2-carboxylic acid 6-(4-Methoxy-3-tricyclo[3.3.1.13,7]dec-1-ylphenyl)-2-naphthalenecarboxylic Acid 6-[4-methoxy-3-(tricyclo[3.3.1.1~3,7~]dec-1-yl)phenyl]naphthalene-2-carboxylic acid |
| CAS | 106685-40-9 |
| EINECS | 620-513-9 |
| InChI | InChI=1/C28H28O3/c1-31-26-7-6-23(21-2-3-22-12-24(27(29)30)5-4-20(22)11-21)13-25(26)28-14-17-8-18(15-28)10-19(9-17)16-28/h2-7,11-13,17-19H,8-10,14-16H2,1H3,(H,29,30) |
| Molecular Formula | C28H28O3 |
| Molar Mass | 412.52 |
| Density | 1.233±0.06 g/cm3(Predicted) |
| Melting Point | 319-3220C |
| Boling Point | 606.3±55.0 °C(Predicted) |
| Flash Point | 205.9°C |
| Solubility | DMSO: >10mg/mL |
| Vapor Presure | 1.49E-15mmHg at 25°C |
| Appearance | Solid |
| Color | white to off-white |
| Merck | 14,150 |
| pKa | 4.2(at 25℃) |
| Storage Condition | 2-8°C |
| Stability | Stable for 1 year from date of purchase as supplied. Solutions in DMSO or DMF may be stored at -20°C for up to 3 months |
| Sensitive | Easily absorbing moisture |
| Refractive Index | 1.654 |
| MDL | MFCD03106112 |
| Use | The retinoic acid analog, Apalene, is a RARβ, and RARγ receptor agonist. Adapalene inhibits cell proliferation and induces apoptosis in colorectal cancer cells in vitro. Adapalene gel is an effective drug for the treatment of acne. |
| WGK Germany | nwg |
| RTECS | QJ1987000 |
| HS Code | 2918992090 |