| Name | Anisoin |
| Synonyms | Anisoin P-ANISOIN 4,4'-anisoin TIMTEC-BB SBB006267 4,4-Dimethoxybenzoin P,P'-DIMETHOXYBENZOIN Benzoin, 4,4'-dimethoxy- P,P'-DIMETHOXYBENZOYLPHENYLCARBINOL 2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone 2-hydroxy-1,2-bis(4-methoxyphenyl)-ethanon (2S)-2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone (2R)-2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone |
| CAS | 119-52-8 |
| EINECS | 204-330-8 |
| InChI | InChI=1/C16H16O4/c1-19-13-7-3-11(4-8-13)15(17)16(18)12-5-9-14(20-2)10-6-12/h3-10,15,17H,1-2H3/t15-/m1/s1 |
| Molecular Formula | C16H16O4 |
| Molar Mass | 272.3 |
| Density | 1.1105 (rough estimate) |
| Melting Point | 108-111°C(lit.) |
| Boling Point | 335.35°C (rough estimate) |
| Flash Point | 171°C |
| Water Solubility | Soluble in water, ethanol and acetone. |
| Vapor Presure | 3.11E-09mmHg at 25°C |
| Appearance | White to yellow powder |
| Color | Pale yellow to beige |
| BRN | 3211892 |
| pKa | 12.14±0.20(Predicted) |
| Storage Condition | Store below +30°C. |
| Refractive Index | 1.4350 (estimate) |
| MDL | MFCD00008411 |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29145090 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |