| Name | Tomoxetine |
| Synonyms | Tomoxetine Atomoxetine TomoxetineHcl (r)-tomoxetine N-Methyl--(2-methylphenoxy)benzenepropanamine n-methyl-3-(2-methylphenoxy)benzenepropanamine N-Methyl-3-(2-methylphenoxy)-3-phenylpropylamine Methyl[(R)-3-phenyl-3-(2-methylphenoxy)propyl]amine (R)-N-Methyl-gamma-(2-methyl-phenoxy)benzenepropanamine (R)-N-Methyl-3-phenyl-3-(2-methylphenoxy)-1-propanamine (3R)-N-methyl-3-(2-methylphenoxy)-3-phenylpropan-1-amine |
| CAS | 83015-26-3 |
| EINECS | 617-427-9 |
| InChI | InChI=1/C17H21NO/c1-14-8-6-7-11-16(14)19-17(12-13-18-2)15-9-4-3-5-10-15/h3-11,17-18H,12-13H2,1-2H3/t17-/m1/s1 |
| Molecular Formula | C17H21NO |
| Molar Mass | 255.36 |
| Density | 1.023±0.06 g/cm3(Predicted) |
| Boling Point | 389.0±37.0 °C(Predicted) |
| Flash Point | 164.1°C |
| Vapor Presure | 2.95E-06mmHg at 25°C |
| pKa | 10.15±0.10(Predicted) |
| Refractive Index | 1.552 |
| Use | For the treatment of attention deficit disorder |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |