| Name | Benzyldiphenylphosphine |
| Synonyms | BENZYLDIPHENYLPHOSPHINE Diphenylbenzylphosphine Benzyldiphenylphosphine benzyl(diphenyl)phosphane Diphenyl(phenylmethyl)phosphine Phosphine, diphenyl(phenylmethyl)- |
| CAS | 7650-91-1 |
| EINECS | 1312995-182-4 |
| InChI | InChI=1/C19H17P/c1-4-10-17(11-5-1)16-20(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15H,16H2 |
| Molecular Formula | C19H17P |
| Molar Mass | 276.31 |
| Melting Point | 77-83 °C (lit.) |
| Boling Point | 399.6°C at 760 mmHg |
| Flash Point | 206.2°C |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 3.12E-06mmHg at 25°C |
| Appearance | White to white-like powder |
| Color | White to off-white |
| Storage Condition | Inert atmosphere,Room Temperature |
| Sensitive | Air Sensitive |
| MDL | MFCD00014083 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| HS Code | 29310099 |