| Name | Benazolin-ethyl |
| Synonyms | Benazolin-ethyl BENAZOLIN-ETHYL BENAZOLIN-ETHYL ESTER ETHYL-4-CHLOR-2-OXO-BENZOTHIAZOLINACETAT ethyl4-chloro-2-oxo-3(2h)-benzothiazoleacetate 4-chloro-2-oxo-3-benzothiazolineaceticaciethylester ethyl 4-chloro-2-oxo-3h-1,3-benzothiazole-3-ylacetate 4-chloro-2-oxo-3(2h)-benzothiazoleaceticaciethylester Ethyl 4-chloro-2-oxo-3H-1,3-benzothiazole-3-ylacetate 4-Chloro-2-oxo-benzothiazoleacetic acid ethyl ester ethyl (4-chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetate 7-chloro-2-oxo-3(2h)-benzothiazoleacetic acid ethyl ester 7-Chloro-2-oxo-3(2H)-benzothiazoleacetic acid ethyl ester ethyl-4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-ylacetate |
| CAS | 25059-80-7 |
| EINECS | 246-591-0 |
| InChI | InChI=1/C11H10ClNO3S/c1-2-16-9(14)6-13-10-7(12)4-3-5-8(10)17-11(13)15/h3-5H,2,6H2,1H3 |
| InChIKey | WQRCEBAZAUAUQC-UHFFFAOYSA-N |
| Molecular Formula | C11H10ClNO3S |
| Molar Mass | 271.72 |
| Density | 1.418±0.06 g/cm3(Predicted) |
| Melting Point | 79°C |
| Boling Point | 408.1±55.0 °C(Predicted) |
| Flash Point | 200.6°C |
| Vapor Presure | 7.16E-07mmHg at 25°C |
| Appearance | neat |
| BRN | 753659 |
| pKa | -2.57±0.20(Predicted) |
| Refractive Index | 1.608 |
| Use | It can be used as a weed control in winter rapeseed fields, and can effectively control a variety of annual Broad-leaved weeds such as pig, breeding, cattle, herringbone, big nest, water spinach, gray vegetable, etc. |
| Hazard Symbols | N - Dangerous for the environment![]() |
| Risk Codes | 51/53 - Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment. |
| Safety Description | 61 - Avoid release to the environment. Refer to special instructions / safety data sheets. |
| UN IDs | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | DL0880000 |
| HS Code | 29342000 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | used for weeding in winter rape fields, it can effectively prevent and remove a variety of annual broadleaf weeds such as pig disaster, chickweed, chickweed, passerine, shepherd's purse, gray vegetable, etc. |