| Name | Benzyloxybromobenzene |
| Synonyms | AURORA KA-4380 Benzyloxybromobenzene 4-Benzyloxybromobenzene BENZYLOXY-4-BROMO BENZENE 1-Bromo-4-benzyloxybenzen 1-Benzyloxy-4-bromobenzene Benzyl 4-bromophenyl ether 1-Bromo-4-benzyloxybenzene BENZYL 4-BROMOPHENYL ETHER Benzyl p-bromophenyl ether 1-Bromo-4-benzyloxybzenzene 1-(Benzyloxy)-4-bromobenzene Benzene, 1-bromo-4-(phenylmethoxy)- 5-(TERT-BUTYLDIMETHYLSILYL)-1-METHYL-1H |
| CAS | 6793-92-6 152120-66-6 |
| EINECS | 614-179-3 |
| InChI | InChI=1/C13H11BrO/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | OUQSGILAXUXMGI-UHFFFAOYSA-N |
| Molecular Formula | C13H11BrO |
| Molar Mass | 263.13 |
| Density | 1.3883 (rough estimate) |
| Melting Point | 60-63 °C (lit.) |
| Boling Point | 166-167 °C/4 mmHg (lit.) |
| Flash Point | 166-167°C/3mm |
| Appearance | White solid |
| BRN | 1371040 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5130 (estimate) |
| MDL | MFCD00028016 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37 - Wear suitable gloves. |
| WGK Germany | 3 |
| HS Code | 29093090 |
| Hazard Class | IRRITANT |
| use | 4-benzyloxybromobenzene is a hydrocarbon derivative, which can be used as a commonly used intermediate in drug synthesis and chemical production. |
| synthesis method | the synthesis process of 4-benzyloxy bromobenzene is as follows: p-bromophenol, chlorobenzyl, anhydrous potassium carbonate and potassium iodide are placed in a 250ml three-mouth bottle, and 170ml of anhydrous ethanol is added. Under stirring, heating and reflux at 80 ℃ for 6h, TLC test showed that the raw materials basically reacted completely. Stop the reaction, pour the reaction solution into 1000ml distilled water, stir fully, and remove the residual inorganic salt. Suction filtration, white-like solid, absolute ethanol recrystallization, 50g off-white powder, 88.5% yield. |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |