| Name | Bindone |
| Synonyms | Bindone Δ1,2'-Biindan-1',3,3'-trione 1,2-biindanylidene-1,3,3-trione 2-(3-oxo-1-indanylidene)-3-indandione 2-(3-oxo-1-indanylidene)-1,3-indandione 2-(3-oxo-1-indanylidene)indan-1,3-dione 2-(3-OXO-1-INDANYLIDENE)INDAN-1,3-DIONE 2-[1-(3-Oxoindanylidene)]-1,3-indandione Bindone [for Detection of Primary Amines] 2-[1-(-3-OXOINDANYLIDENE)]-1,3-INDANEDIONE Δ1,2'(3'H)-Bi[1H-indene]-1',3,3'(2H)-trione 2-(2,3-Dihydro-3-oxo-1H-inden-1-ylidene)-1H-indene-1,3(2H)-dione 2-(3-oxo-2,3-dihydro-1H-inden-1-ylidene)-1H-indene-1,3(2H)-dione |
| CAS | 1707-95-5 |
| EINECS | 216-956-9 |
| InChI | InChI=1/C18H10O3/c19-15-9-14(10-5-1-2-6-11(10)15)16-17(20)12-7-3-4-8-13(12)18(16)21/h1-8H,9H2 |
| Molecular Formula | C18H10O3 |
| Molar Mass | 274.27 |
| Density | 1.2968 (rough estimate) |
| Melting Point | 205-208°C |
| Boling Point | 357.26°C (rough estimate) |
| Flash Point | 224.5°C |
| Vapor Presure | 1.61E-10mmHg at 25°C |
| Color | Yellow plates |
| BRN | 1884961 |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.4700 (estimate) |
| MDL | MFCD00021233 |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| RTECS | NK6050000 |
| Toxicity | LDLo ipr-mus: 100 mg/kg ARTODN 33,191,75 |