| Name | Bischloromethylanthracene |
| Synonyms | icr-450 Bischloromethylanthracene 9,10-DI(CHLOROMETHYL)ANTHRACENE 9,10-Bis(chloromethyl)anthracene 9,10-BIS(CHLOROMETHYL)ANTHRACENE 9,10-bis(chloromethyl)-anthracen 9, 10-DI(CHLOROMETHYL)ANTHRACENE 9,10-Dis-(chloromethyl)anthracene 2,2-Dichloro-N-methyldiethylamineHCl |
| CAS | 10387-13-0 |
| EINECS | 677-977-0 |
| InChI | InChI=1/C16H12Cl2/c17-9-15-11-5-1-2-6-12(11)16(10-18)14-8-4-3-7-13(14)15/h1-8H,9-10H2 |
| Molecular Formula | C16H12Cl2 |
| Molar Mass | 275.17 |
| Density | 1.1151 (rough estimate) |
| Melting Point | 258-260°C |
| Boling Point | 355.58°C (rough estimate) |
| Flash Point | 242.4°C |
| Solubility | very faint turbidity in hot Toluene |
| Vapor Presure | 3.09E-08mmHg at 25°C |
| Appearance | Yellow crystal |
| Color | Crystals from xylene; yellow blades from toluene |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Refractive Index | 1.5610 (estimate) |
| MDL | MFCD00045388 |
| Physical and Chemical Properties | Content: 97%(HPLC) Appearance: yellow crystals |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| UN IDs | 3261 |
| RTECS | CA9365000 |
| Hazard Class | 8 |
| Packing Group | II |
| Toxicity | mma-sat 100 ng/plate PNASA6 72,5135,75 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| category | toxic substances |
| toxicity classification | highly toxic |
| acute toxicity | vein-mouse LD50: 56 mg/kg |
| flammability hazard characteristics | combustible; combustion produces toxic chloride smoke |
| storage and transportation characteristics | warehouse ventilation and low temperature drying; separate from food raw materials |
| fire extinguishing agent | dry powder, foam, sand, carbon dioxide, mist water |