| Name | Bromotriphenylethylene |
| Synonyms | AURORA KA-6594 triphenylvinyl bromide BROMOTRIPHENYLETHYLENE bromotriphenyl-ethylen Bromotriphenylethylene à-bromo-à'-phenylstilbene 2-BROMO-1,1,2-TRIPHENYLETHYLENE 1-bromo-1,2,2-triphenylethylene Benzene, 1,1,1-(1-bromo-1-ethenyl-2-ylidene)tris- |
| CAS | 1607-57-4 |
| EINECS | 216-531-8 |
| InChI | InChI=1/C20H15Br/c21-20(18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-15H |
| Molecular Formula | C20H15Br |
| Molar Mass | 335.24 |
| Density | 1.311g/cm3 |
| Melting Point | 115-117℃ |
| Boling Point | 399.9°C at 760 mmHg |
| Flash Point | 213.6°C |
| Vapor Presure | 3.05E-06mmHg at 25°C |
| Storage Condition | Room Temprature |
| Refractive Index | 1.648 |
| MDL | MFCD00000135 |
| Physical and Chemical Properties |
|
| Use | Used as an intermediate in organic synthesis |
| Safety Description | S24/25 - Avoid contact with skin and eyes. |
| storage conditions | Inert atmosphere,2-8°C |
| BRN | 2052962 |
| use | Used as an intermediate in organic synthesis |
| category | toxic substances |
| flammability hazard characteristics | Thermal decomposition discharges toxic bromide smoke |
| storage and transportation characteristics | warehouse ventilation and low temperature drying |
| fire extinguishing agent | Water, dry powder, dry sand, carbon dioxide, foam, 1211 fire extinguishing agent |
| WGK Germany | 3 |
| RTECS number | KU8850000 |
| customs code | 29036990 |