| Name | cefteram |
| Synonyms | T-2525 Tomimn CEFTERAM cefteram Ceftetrame Ro-19-5247 Cefteram pivoxil (6R,7R)-7-{[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-[(5-methyl-2H-tetrazol-2-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-[(5-methyl-2H-tetrazol-2-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid 2,2-Dimethylpropanoyloxymethyl (6R,7R)-7-[(Z)-2-(2-aminothiazol-4-yl)-2-methoxyiminoacetylamino]-3-(5-methyl-2H-tetrazol-2-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| CAS | 82547-58-8 |
| InChI | InChI=1/C16H17N9O5S2/c1-6-20-23-24(21-6)3-7-4-31-14-10(13(27)25(14)11(7)15(28)29)19-12(26)9(22-30-2)8-5-32-16(17)18-8/h5,10,14H,3-4H2,1-2H3,(H2,17,18)(H,19,26)(H,28,29)/b22-9-/t10-,14-/m1/s1 |
| Molecular Formula | C16H17N9O5S2 |
| Molar Mass | 479.49 |
| Density | 1.95±0.1 g/cm3(Predicted) |
| Melting Point | >175°C (dec.) |
| Solubility | DMF (Slightly), DMSO (Slightly), Methanol (Slightly) |
| Appearance | Solid |
| Color | White to Pale Yellow |
| pKa | 2.62±0.50(Predicted) |
| Storage Condition | -20°C Freezer |
| Refractive Index | 1.901 |
| Physical and Chemical Properties | Crystallization from acetone, melting point> 200 °c. Cefteram Pivoxil: C22H27N9O7S2. [82547-81-7]. That is, its trimethylacetylmethoxy ester. White to yellowish white crystalline powder, odorless or slightly odorous, bitter in taste. Soluble in methanol, ethanol, chloroform or acetone, very slightly soluble in ether, a few insoluble in water. Melting point 127~128 °c (decomposition). Acute toxicity LD50 male and female mice, male and female rats (g/kg):>6.00,5.86,5.63,5.09 intraperitoneal injection; All> 6.00 subcutaneous injection. Acute toxicity LD50 male mice, rats, dogs (g/kg):>6.00,>6.00,>2.00 orally. |