| Name | Cyanophenylpiperazine |
| Synonyms | RARECHEM AH CK 0076 Cyanophenylpiperazine 1-(2-CYANOPHENYL)PIPERAZINE 1-(2-CYANPHENYL)-PIPERAZINE 1-(2-Cyanophenyl)piperazine 2-(1-Piperazino)benzonitrile 2-piperazin-1-ylbenzonitrile Benzonitrile, 2-(1-piperazinyl)- (9CI) |
| CAS | 111373-03-6 |
| InChI | InChI=1/C11H13N3/c12-9-10-3-1-2-4-11(10)14-7-5-13-6-8-14/h1-4,13H,5-8H2 |
| Molecular Formula | C11H13N3 |
| Molar Mass | 187.24 |
| Density | 1.115 g/mL |
| Melting Point | 113-115 |
| Boling Point | 314-315 °C (lit.) |
| Flash Point | 118°F |
| Vapor Presure | 1.19E-05mmHg at 25°C |
| Appearance | clear liquid |
| Specific Gravity | 1.115 |
| Color | Colorless to Light orange to Yellow |
| BRN | 785973 |
| pKa | 8.77±0.10(Predicted) |
| Sensitive | Moisture Sensitive |
| Refractive Index | n20/D 1.5890(lit.) |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R10 - Flammable R36 - Irritating to the eyes |
| Safety Description | S16 - Keep away from sources of ignition. S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. |
| UN IDs | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| Hazard Class | 8 |
| Packing Group | II |