| Name | 1,4,7,10-tetraazacyclododecane-1,4,7,10-tetraacetic acid |
| Synonyms | DOTA NSC 681107 TETRAXETAN TETRAAZA-12-CROWN-4-1,4,7,10-TETRAACETIC ACID 1,4,7,10-tetraazacyclododecane-1,4,7,10-tetraacetic acid 1,4,7,10-TETRAAZACYCLODODECANE-1,4,7,10-TETRAACETIC ACID 1,4,7,10-TETRAAZACYCLODODECANE-N,N',N'',N'''-TETRAACETIC ACID 1,4,7,10-TETRAAZACYCLODODECANE-1,4,7,10-TETRAACETIC ACID, FREE ACID 2,2',2'',2'''-(1,4,7,10-tetraazacyclododecane-1,4,7,10-tetrayl)tetraacetic acid |
| CAS | 60239-18-1 |
| EINECS | 611-959-5 |
| InChI | InChI=1/C16H28N4O8/c21-13(22)9-17-1-2-18(10-14(23)24)5-6-20(12-16(27)28)8-7-19(4-3-17)11-15(25)26/h1-12H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28) |
| Molecular Formula | C16H28N4O8 |
| Molar Mass | 404.42 |
| Density | 1.321 |
| Melting Point | 267 °C |
| Boling Point | 701.6±60.0 °C(Predicted) |
| Flash Point | 378.1°C |
| Solubility | Water (Slightly, Heated), Methanol (Slightly) |
| Vapor Presure | 1.51E-21mmHg at 25°C |
| Appearance | Morphology Powder |
| Color | white |
| BRN | 1186987 |
| pKa | 2.16±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Stability | Hygroscopic |
| Refractive Index | 1.531 |
| MDL | MFCD00068657 |
| Use | Use of rostrine tetra acetic acid (DOTA) is a gadolinium-containing contrast agent. This drug is used for magnetic resonance imaging (mri) examination of the patient's central nervous system. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 3-10-34 |
| HS Code | 29339900 |
| appearance | white or white-like crystallinity |
| use | rostrine tetraacetic acid (DOTA) is a gadolinium-containing contrast agent. This drug is used for magnetic resonance imaging (mri) examination of the patient's central nervous system. |
| Solubility | Water (Slightly, Heated), Methanol (Slightly) |