| Name | Decenone |
| Synonyms | Decenone FEMA 3532 3-Decen-2-one 3-DECEN-2-ONE dec-3-en-2-one (3E)-3-Decen-2-one (3E)-dec-3-en-2-one Heptylidene acetone Oenanthylidene acetone Methyl(1-octenyl) ketone |
| CAS | 10519-33-2 |
| EINECS | 234-059-0 |
| InChI | InChI=1/C10H18O/c1-3-4-5-6-7-8-9-10(2)11/h8-9H,3-7H2,1-2H3/b9-8+ |
| Molecular Formula | C10H18O |
| Molar Mass | 154.25 |
| Density | 0.847g/mLat 25°C(lit.) |
| Melting Point | 74.5°C (estimate) |
| Boling Point | 125°C12mm Hg(lit.) |
| Flash Point | 198°F |
| JECFA Number | 1130 |
| Vapor Presure | 0.102mmHg at 25°C |
| Storage Condition | 2-8℃ |
| Refractive Index | n20/D 1.45(lit.) |
| MDL | MFCD00015700 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36 - Irritating to the eyes R52 - Harmful to aquatic organisms |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| TSCA | Yes |
| FEMA | 3532 | 3-DECEN-2-ONE |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |