| Name | Diethylbenzene |
| Synonyms | Diethylbenzene m-diethyl-benzen M-Diethylbenzene M-DIETHYLBENZENE 1,3-Diethylbenzene 1,3-diethyl-benzen 1,3-DIETHYLBENZENE Benzene, m-diethyl- meta-Diethylbenzene |
| CAS | 141-93-5 |
| EINECS | 205-511-4 |
| InChI | InChI=1/C10H14/c1-3-9-6-5-7-10(4-2)8-9/h5-8H,3-4H2,1-2H3 |
| Molecular Formula | C10H14 |
| Molar Mass | 134.22 |
| Density | 0.864g/mLat 20°C(lit.) |
| Melting Point | -84°C(lit.) |
| Boling Point | 182 °C |
| Flash Point | 50°C |
| Water Solubility | Miscible with ethanol, benzene, carbon tetrachloride, ethyl ether and acetone. Immiscible with water and diethylbenzene. |
| Vapor Presure | 1.15mmHg at 25°C |
| Appearance | Liquid |
| Color | Colorless to Almost colorless |
| BRN | 1903394 |
| Refractive Index | n20/D 1.496 |
| Physical and Chemical Properties | Melting Point:-84 Boiling Point: 181 density: 0.864 refractive index: 1.4955
|
| Use | Mainly used for the production of divinylbenzene |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R10 - Flammable R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | UN 2049 3/PG 3 |
| WGK Germany | 3 |
| RTECS | CZ5620000 |
| TSCA | Yes |
| Hazard Class | 3 |
| Packing Group | III |
| olfactory Threshold | 0.07ppm |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| purpose | mainly used for the production of divinylbenzene |
| category | combustible articles |
| toxicity grade | low toxicity |
| Acute toxicity | oral-rat LDL0: 5000 mg/kg |
| flammability hazard characteristics | flammable in open flame, high temperature, strong oxidant; combustion emissions |
| storage and transportation characteristics | The package is complete, light and light unloading; The warehouse is ventilated, away from open flame, high temperature, separate from oxidant |
| fire extinguishing agent | foam, dry powder, carbon dioxide, sand |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |