| Name | Ethylboronic acid |
| Synonyms | Ethylboronic ethylboric acid Ethylboronic acid ETHYLBORONIC ACID Ethaneboronic acid RARECHEM AH PB 0253 Boronic acid, ethyl- |
| CAS | 4433-63-0 |
| EINECS | 670-253-5 |
| InChI | InChI=1/C2H7BO2/c1-2-3(4)5/h4-5H,2H2,1H3 |
| Molecular Formula | C2H7BO2 |
| Molar Mass | 73.89 |
| Density | 0.941g/cm3 |
| Melting Point | 161-162°C |
| Boling Point | 154°C at 760 mmHg |
| Flash Point | 47°C |
| Solubility | DMSO (Slightly), Water (Slightly) |
| Vapor Presure | 1.19mmHg at 25°C |
| Appearance | Crystalline Powder, Needles or Flakes |
| Color | White to slightly yellow |
| BRN | 1731546 |
| Storage Condition | Inert atmosphere,Store in freezer, under -20°C |
| Sensitive | Hygroscopic |
| Refractive Index | 1.371 |
| MDL | MFCD01074536 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| TSCA | No |
| HS Code | 29319090 |
| Hazard Class | IRRITANT, KEEP COLD |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |