| Name | Fluanisone |
| Synonyms | 2028 Md 216-038-8 Anti-pica Fluanison 1480-19-9 Fluanisone 4-[4-(o-Methoxyphenyl)-1-piperazinyl]-p-fluorobutyrophenone 4'-Fluoro-4-[4-(o-methoxyphenyl)-1-piperazinyl]butyrophenone Butyrophenone, 4'-fluoro-4-[4-(o-methoxyphenyl)-1-piperazinyl]- Butyrophenone, 4'-fluoro-4-[4- (o-methoxyphenyl)-1-piperazinyl]- 1-Butanone, 1-(4-fluorophenyl)-4-4-(2-methoxyphenyl)-1-piperazinyl- 1-(4-Fluorophenyl)-4-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-one 1-butanone, 1-(4-fluorophenyl)-4-[4-(2-methoxyphenyl)-1-piperazinyl]- |
| CAS | 1480-19-9 |
| EINECS | 216-038-8 |
| InChI | InChI=1/C21H25FN2O2/c1-26-21-7-3-2-5-19(21)24-15-13-23(14-16-24)12-4-6-20(25)17-8-10-18(22)11-9-17/h2-3,5,7-11H,4,6,12-16H2,1H3 |
| Molecular Formula | C21H25FN2O2 |
| Molar Mass | 356.43 |
| Density | 1.146 |
| Melting Point | 67.5-68.5° |
| Boling Point | 511.8±50.0 °C(Predicted) |
| Flash Point | 263.3°C |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Vapor Presure | 1.38E-10mmHg at 25°C |
| Appearance | Solid |
| Color | Off-White to Pale Yellow |
| pKa | 7.43±0.10(Predicted) |
| Storage Condition | Refrigerator |
| Refractive Index | 1.557 |
| Toxicity | LD50 i.p. in mice: 200 mg/kg (Cascio) |
| application | fluanidone is a typical antipsychotic and sedative butyrylbenzene chemicals. It is used as an adjunct to independent psychomotor excitement for severe and chronic schizophrenia and manic-depressive disorders. |