| Name | Glutarimide |
| Synonyms | Glutarimide GLUTARIMIDE 2,6-PIPERIDINEDIONE 2,6-Dioxopiperidine 2,6-DIKETOPIPERIDINE PIPERIDINE-2,6-DIONE Piperidine-2,6-dione 2,6-Diketopiperidine2,6-Piperidinedione |
| CAS | 1121-89-7 |
| EINECS | 214-340-4 |
| InChI | InChI=1/C5H7NO2/c7-4-2-1-3-5(8)6-4/h1-3H2,(H,6,7,8) |
| InChIKey | KNCYXPMJDCCGSJ-UHFFFAOYSA-N |
| Molecular Formula | C5H7NO2 |
| Molar Mass | 113.11 |
| Density | 1.2416 (rough estimate) |
| Melting Point | 155-157 °C (lit.) |
| Boling Point | 211.82°C (rough estimate) |
| Flash Point | 152.3°C |
| Water Solubility | Soluble in water, hot ethanol and boiling benzene. Insoluble in ether. |
| Vapor Presure | 0.0024mmHg at 25°C |
| Appearance | White solid |
| Color | White |
| BRN | 110052 |
| pKa | pKa 11.4 (Uncertain) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.4200 (estimate) |
| MDL | MFCD00006670 |
| Physical and Chemical Properties | Melting point 154-157°C |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36 - Irritating to the eyes |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| RTECS | MA4000000 |
| HS Code | 29251995 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | glutarimide is used in the preparation method of optical resin of optical protective film. |