| Name | Glycoluril |
| Synonyms | Glycoluril Acetyleneurea Glyoxalbiuret Glyoxaldiurene Glyoxaldiureine Diurea glyoxalate Acetylenediureine Acetylene carbamide di-1,2-ureyleneethane perhydroimidazo(4,5-d)imidazole-2,5-dione 5-d]imidazole-2,5(1h,3h)-dione,tetrahydro-imidazo[ 5-d]imidazole-2,5(1H,3H)-dione,tetrahydro-Imidazo[4 Tetrahydroimidazo[4,5-d]imidazole-2,5-(1H,3H)-dione |
| CAS | 496-46-8 |
| EINECS | 207-821-5 |
| InChI | InChI=1/C4H6N4O2/c9-3-5-1-2(7-3)8-4(10)6-1/h1-2H,(H2,5,7,9)(H2,6,8,10) |
| Molecular Formula | C4H6N4O2 |
| Molar Mass | 142.12 |
| Density | 1.4926 (rough estimate) |
| Melting Point | >300 °C (lit.) |
| Boling Point | 259.66°C (rough estimate) |
| Flash Point | 421.8°C |
| Water Solubility | 1.8g/L at 20℃ |
| Solubility | 15g/l |
| Vapor Presure | 0Pa at 25℃ |
| Appearance | powder to crystal |
| Color | White to Almost white |
| Merck | 14,93 |
| BRN | 128826 |
| pKa | 12.91±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.8500 (estimate) |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 1 |
| HS Code | 29332990 |
| LogP | -3.28 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Preparation | Glycoluril was synthesized from urea and glyoxal under acid-catalyzed conditions. |
| use | as water treatment agent |