| Name | 1-Indanone |
| Synonyms | IDO 1-Indone 1-Indanone I-Indanone A-HYDRINDONE alpha-Indanone ALPHA-HYDRINDON Dihydro-1-indenone 2,3-Dihydro-1-indanone 2,3-Dihydro-1-indenone 2,3-dihydroinden-1-one 2,3-dihydro-1h-inden-1-on 4-fluorosulfonylbenzoic acid [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-2-oxolanyl]methyl ester hydrochloride |
| CAS | 83-33-0 |
| EINECS | 201-470-1 |
| InChI | InChI=1/C9H8O/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4H,5-6H2 |
| InChIKey | QNXSIUBBGPHDDE-UHFFFAOYSA-N |
| Molecular Formula | C9H8O |
| Molar Mass | 132.16 |
| Density | 1.103g/mLat 25°C(lit.) |
| Melting Point | 38-40°C(lit.) |
| Boling Point | 243-245°C(lit.) |
| Flash Point | 233°F |
| Water Solubility | 6.5 g/L (20 C) |
| Solubility | 6.5g/l |
| Appearance | White crystal |
| Color | Light yellow to brown |
| BRN | 507957 |
| Storage Condition | Store below +30°C. |
| Refractive Index | 1.5610 (estimate) |
| MDL | MFCD00003785 |
| Physical and Chemical Properties | Density 1.1 melting point 38-42°C boiling point 243-245°C flash point 111°C water-soluble 6.5g/L (20 C) |
| Use | For Organic synthesis |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29143900 |
| Hazard Note | Irritant |
| olfactory Threshold | 0.0088ppm |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | an important intermediate for the synthesis of Indinavir (Indinavir). 1-indanone is used in organic synthesis. |
| production method | dry hydrogen chloride was passed through the freshly distilled indene at a temperature of 5-10 °c, 8-10H was required for the reaction, and the reaction product was distilled under reduced pressure, and 90-103(1.73kPa) was collected to obtain α-chloroindene. This was oxidized with chromium trioxide in glacial acetic acid at a temperature of 35-40 °c to produce dihydro-1-indanone. The yield ranged from 50% to 60%. |
| autoignition temperature | 525°C |