| Name | 2-Ethylhexyl acetate |
| Synonyms | IOAC NSC 8897 AI3-07924 HSDB 2668 BRN 1758321 femanumber2806 FEMA Number 2806 ethylhexylacetate octan-3-yl acetate Ethyl hexyl acetate 2-Ethylhexyl acetate 2-Ethylhexanyl acetate 2-Ethylhexyl ethanoate Ethyl(2)-hexyl acetate beta-ethylhexylacetate 2-Ethyl-1-hexyl acetate beta-Ethylhexyl acetate (2R)-2-ethylhexyl acetate 2-Ethyl-1-hexanol acetate Acetic acid, 2-ethylhexyl ester 2-Ethylhexylester kyseliny octove Acetic acid alpha-ethylhexyl ester ethylhexylacetate(non-specificname) 2-Ethylhexylester kyseliny octove [Czech] 4-02-00-00166 (Beilstein Handbook Reference) |
| CAS | 103-09-3 12261-98-2 |
| EINECS | 203-079-1 |
| InChI | InChI=1/C10H20O2/c1-4-6-7-10(5-2)8-12-9(3)11/h10H,4-8H2,1-3H3/t10-/m1/s1 |
| InChIKey | WOYWLLHHWAMFCB-UHFFFAOYSA-N |
| Molecular Formula | C10H20O2 |
| Molar Mass | 172.26 |
| Density | 0.87g/mLat 25°C(lit.) |
| Melting Point | −92°C(lit.) |
| Boling Point | 199°C(lit.) |
| Flash Point | 185°F |
| JECFA Number | 130 |
| Water Solubility | 3.9mg/L at 20℃ |
| Solubility | water: slightly soluble0.0039 g/L |
| Vapor Presure | 0.28 hPa (20 °C) |
| Appearance | Liquid |
| Color | Clear colorless |
| Merck | 14,6763 |
| BRN | 1758321 |
| Storage Condition | Store below +30°C. |
| Explosive Limit | 0.76-8.14%(V) |
| Refractive Index | n20/D 1.418(lit.) |
| Physical and Chemical Properties | |
| Use | Used as additives for high-grade paints, high-grade coatings and leather brighteners |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R38 - Irritating to the skin |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 1 |
| RTECS | AH5600000 |
| TSCA | Yes |
| HS Code | 29153990 |
| Toxicity | LD50 orally in rats: 3.0 g/kg (Smyth, Carpenter) |
| LogP | 4.2 at 25℃ |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Application | used as an additive for high-grade paint, high-grade paint and leather brightener |
| production method | purification method: contains free acid and alcohol impurities. Purification with sodium bicarbonate or sodium carbonate solution washing, anhydrous sodium carbonate or sodium sulfate after drying distillation. |
| category | flammable liquid |
| toxicity grade | poisoning |
| Acute toxicity | oral-rat LD50: 3000 mg/kg; Oral-mouse LD50: 3200 mg/kg |
| stimulation data | Skin-rabbit 500 mg mild; eye-rabbit 0.25 mg/24 h severe |
| explosive hazard characteristics | mixture with air, heat, open flame can be broken |
| flammability hazard characteristics | flammability; Combustion stimulus smoke |
| storage and transportation characteristics | warehouse ventilation and low temperature drying |
| extinguishing agent | dry powder, foam, sand, water |
| spontaneous combustion temperature | 268°C |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |