| Name | Isoquinoline-1-carbaldehyde |
| Synonyms | 1-FORMYLISOQUINOLINE 1-Isoquinolinecarbaldehyde 1-isquinolinecarboxaldehyde Isoquinoline-1-carbaldehyde ISOQUINOLINE-1-CARBALDEHYDE 1-Isoquinolinecarboxaldehyde Isoquinoline-1-carboxaldehyde |
| CAS | 4494-18-2 |
| EINECS | 200-258-5 |
| InChI | InChI=1/C10H7NO/c12-7-10-9-4-2-1-3-8(9)5-6-11-10/h1-7H |
| Molecular Formula | C10H7NO |
| Molar Mass | 157.17 |
| Density | 1.223±0.06 g/cm3(Predicted) |
| Melting Point | 55-55.5 °C |
| Boling Point | 308.6±15.0 °C(Predicted) |
| Flash Point | 148.356°C |
| Vapor Presure | 0.001mmHg at 25°C |
| pKa | 2.06±0.30(Predicted) |
| Storage Condition | Inert atmosphere,Store in freezer, under -20°C |
| Refractive Index | 1.687 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R36 - Irritating to the eyes R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37 - Wear suitable protective clothing and gloves. S24/25 - Avoid contact with skin and eyes. |
| HS Code | 29334900 |