| Name | Isoquinoline-4-carbaldehyde |
| Synonyms | RARECHEM AK ML 0134 4-Formylisoquinoline ISOQUINOLINE-4-CARBALDEHYDE Isoquinoline-4-carbaldehyde 4-Isoquinolinecarboxaldehyde 4-ISOQUINOLINECARBOXALDEHYDE Isoquinoline-4-carboxaldehyde 4-Isoquinolinecarboxaldehyde (7CI,8CI,9CI) |
| CAS | 22960-16-3 |
| InChI | InChI=1/C10H7NO/c12-7-9-6-11-5-8-3-1-2-4-10(8)9/h1-7H |
| Molecular Formula | C10H7NO |
| Molar Mass | 157.17 |
| Density | 1.223±0.06 g/cm3(Predicted) |
| Melting Point | 101-106℃ |
| Boling Point | 331.7±15.0 °C(Predicted) |
| Flash Point | 162.4°C |
| Vapor Presure | 0.000153mmHg at 25°C |
| pKa | 3.49±0.10(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.687 |
| MDL | MFCD00829440 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R36 - Irritating to the eyes R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S22 - Do not breathe dust. |
| UN IDs | 2811 |
| WGK Germany | 3 |
| HS Code | 29339900 |