| Name | Letrozole |
| Synonyms | Femara Lelrozol Letrozol Letrazole Letrozole 112809-51-5 4,4'-(1h-1,2,4-Triazol-1-Ylmethylene)Bisbenzonitrile 4,4'-(1h-1,2,4-Triazol-1-Ylmethylene) Bis-Benzonitrile |
| CAS | 112809-51-5 |
| InChI | InChI=1/C17H11N5/c18-9-13-1-5-15(6-2-13)17(22-12-20-11-21-22)16-7-3-14(10-19)4-8-16/h1-8,11-12,17H |
| Molecular Formula | C17H11N5 | |
| Melting Point | 181-183℃ | |
| Boling Point | 374.4°C at 760 mmHg | |
| Solubility | DMSO: >50 mg/mL | |
| Appearance | white to off-white(powder) | |
| Storage Condition | 2-8℃ | |
| MDL | MFCD00866241 | |
| Physical and Chemical Properties | Melting point 181-183°C
| |
| Use | For the treatment of breast cancer |