| Name | Luteolin |
| Synonyms | LUTEOLIN Luteolin LUTEOLOL C.I. 75590 C.I. Natural Yellow 2 3,4,5,7-Tetrahydroxyflavone 5,7,3',4'-TETRAHYDROXYFLAVONE LUTEOLIN-3',7-O-DIGLUCURONIDE 3',4',5,7-TETRAHYDROXYFLAVONE,FLACITRAN,LUTEOLOL 2-(3,4-DIHYDROXY-PHENYL)-5,7-DIHYDROXY-CHROMEN-4-ONE 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-4-one 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4h-1-benzopyran-4-on 2-(3,4-DIHYDROXYPHENYL)-5,7-DIHYDROXY-4H-1-BENZOPYRAN-4-ONE |
| CAS | 491-70-3 |
| EINECS | 207-741-0 |
| InChI | InChI=1/C15H10O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-6,16-19H |
| InChIKey | IQPNAANSBPBGFQ-UHFFFAOYSA-N |
| Molecular Formula | C15H10O6 |
| Molar Mass | 286.24 |
| Density | 1.2981 (rough estimate) |
| Melting Point | ~330°C(lit.) |
| Boling Point | 348.61°C (rough estimate) |
| Flash Point | 239.5°C |
| Water Solubility | Soluble in aqueous alkaline solutions (1.4 mg/ml), ethanol (~5 mg/ml), dimethyl sulfoxide (7 mg/ml), 1eq. Sodium hydroxide (5 mM), dimethylformamide (~20 mg/ml), water (1 mg/ml) at 25°C and methanol. |
| Solubility | Slightly soluble in water, weakly acidic, soluble in alkaline solution |
| Vapor Presure | 9.03E-16mmHg at 25°C |
| Appearance | Yellow needle crystal |
| Color | yellow |
| Merck | 14,5614 |
| BRN | 292084 |
| pKa | 6.50±0.40(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.4413 (estimate) |
| MDL | MFCD00017309 |
| Physical and Chemical Properties | Melting Point: 330°C |
| Use | Used as antitussive, expectorant and anti-inflammatory drugs |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| WGK Germany | 3 |
| RTECS | LK9275210 |
| HS Code | 29329990 |