| Name | Methylurea |
| Synonyms | Methylurea N-Methylurea N-METHYLUREA 1-methylurea Methylurea 250 MONOMETHYLUREA Monomethyl urea Mono methyl urea N-monomethylurea |
| CAS | 598-50-5 |
| EINECS | 209-935-0 |
| InChI | InChI=1/C2H6N2O/c1-4-2(3)5/h1H3,(H3,3,4,5) |
| InChIKey | XGEGHDBEHXKFPX-UHFFFAOYSA-N |
| Molecular Formula | C2H6N2O |
| Molar Mass | 74.08 |
| Density | 1.2040 |
| Melting Point | ~93°C |
| Boling Point | 131.34°C (rough estimate) |
| Flash Point | 23.1°C |
| Water Solubility | 1000 g/L (20 ºC) |
| Solubility | 1000g/l (Lit.) |
| Vapor Presure | 0.003-0.005Pa at 20-23.3℃ |
| Appearance | White to white-like crystals |
| Specific Gravity | 1.204 |
| Color | White to off-white |
| BRN | 878189 |
| pKa | 14.38±0.46(Predicted) |
| PH | 6.7 (50g/l, H2O, 20℃) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.4264 (estimate) |
| MDL | MFCD00007950 |
| Use | For organic synthesis and the pharmaceutical industry |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R68 - Possible risk of irreversible effects R37 - Irritating to the respiratory system R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S22 - Do not breathe dust. S36 - Wear suitable protective clothing. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S36/37 - Wear suitable protective clothing and gloves. |
| WGK Germany | 3 |
| RTECS | YT7175000 |
| TSCA | Yes |
| HS Code | 29241900 |
| LogP | -1.16 at 25℃ and pH7.7 |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | for organic synthesis and pharmaceutical industry |