| Name | N-Acetyl-D-Phenylalanine |
| Synonyms | Ac-D-Phe-OH Acetylphenylalanine N-Acetyl-D-phenylala Acetyl-D-Phenylalanine D-N-Acetylphenylalanine N-Acetyl-D-Phenylalanine D-Phenylalanine,N-acetyl- N-Acetyl-(R)-phenylalanine D-(-)-N-Acetylphenylalanine (R)-2-acetaMido-3-phenylpropanoic acid (2R)-2-(1-hydroxyethenylamino)-3-phenylpropanoic acid |
| CAS | 10172-89-1 |
| EINECS | 233-447-7 |
| InChI | InChI=1/C11H13NO3/c1-8(13)12-10(11(14)15)7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15)/t10-/m1/s1 |
| Molecular Formula | C11H13NO3 |
| Molar Mass | 207.23 |
| Density | 1.199±0.06 g/cm3(Predicted) |
| Melting Point | 167°C |
| Boling Point | 453.9±38.0 °C(Predicted) |
| Flash Point | 228.3°C |
| Solubility | DMSO (Slightly), Methanol (Sparingly) |
| Vapor Presure | 4.96E-09mmHg at 25°C |
| Appearance | White crystal |
| Color | White |
| pKa | 3.56±0.10(Predicted) |
| Storage Condition | Sealed in dry,Store in freezer, under -20°C |
| Refractive Index | -41 ° (C=5, MeOH) |
| MDL | MFCD00002664 |
| Use | Chiral chemical raw materials and pharmaceutical intermediates. It is the drug of choice for the synthetic treatment of type 2 diabetes. |
| WGK Germany | 3 |
| Reference Show more | 1. [IF=7.514] YueTong Yu et al."Identification and Quantification of Oligomeric Proanthocyanidins, Alkaloids, and Flavonoids in Lotus Seeds: A Potentially Rich Source of Bioactive Compounds."Food Chem. 2022 Jan;:132124 |
| uses | chiral chemical raw materials and pharmaceutical intermediates. It is the drug of choice for the synthetic treatment of type 2 diabetes. |