| Name | N-Ethyl naphthylamine |
| Synonyms | N-Ethyl naphthylamine N-ETHYL-1-NAPHTHYLAMINE N-ETHYL-A-NAPHTHYLAMINE N-Ethyl-α-naphthylamine n-ethyl-1-naphthalenamin Ethyl-alpha-naphthylamine N-ethylnaphthalen-1-amine 2-(Ethylamino)naphthalene 1-Naphthylamine, N-ethyl- N-Ethyl-alpha-naphthylamine |
| CAS | 118-44-5 |
| EINECS | 204-250-3 |
| InChI | InChI=1/C12H13N/c1-2-13-12-9-5-7-10-6-3-4-8-11(10)12/h3-9,13H,2H2,1H3 |
| Molecular Formula | C12H13N |
| Molar Mass | 171.24 |
| Density | 1.065 g/mL at 25 °C (lit.) |
| Melting Point | 164-165 °C (decomp)(Solv: ethyl ether (60-29-7)) |
| Boling Point | 175-176 °C/15 mmHg (lit.) |
| Flash Point | >230°F |
| Vapor Presure | 0.00067mmHg at 25°C |
| BRN | 2207404 |
| pKa | 5.12±0.20(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | n20/D 1.644(lit.) |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | 36/37 - Wear suitable protective clothing and gloves. |
| UN IDs | 2810 |
| WGK Germany | 2 |
| FLUKA BRAND F CODES | 8-10-23 |
| TSCA | Yes |
| HS Code | 29214500 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| Use | Used as dye intermediate |
| production method | is obtained by alkylation of methyl naphthylamine, salt formation and neutralization. |