| Name | NETROPSIN |
| Synonyms | f6 t1384 k-117 ia887 2814-a ch-777-a NETROPSIN congocidin ultrapuregrade antibiotic1142 antibiotict-1384 1'-dimethyl-l)amino)- Congocidin, Sinanomycin n,4'-bi(pyrrole-2-carboxamide),n'-(2-carbamoylethyl)-4-((2-guanidinoacetimidoy N-(5-{[(3Z)-3-amino-3-iminopropyl]carbamoyl}-1-methyl-1H-pyrrol-3-yl)-4-{[N-(diaminomethylidene)glycyl]amino}-1-methyl-1H-pyrrole-2-carboxamide N-(4-{[(3Z)-3-amino-3-iminopropyl]carbamoyl}-1-methyl-1H-pyrrol-3-yl)-4-{[N-(diaminomethylidene)glycyl]amino}-1-methyl-1H-pyrrole-2-carboxamide dihydrochloride |
| CAS | 1438-30-8 |
| EINECS | 634-294-2 |
| InChI | InChI=1/C18H26N10O3.2ClH/c1-27-8-11(16(30)23-4-3-14(19)20)12(9-27)26-17(31)13-5-10(7-28(13)2)25-15(29)6-24-18(21)22;;/h5,7-9H,3-4,6H2,1-2H3,(H3,19,20)(H,23,30)(H,25,29)(H,26,31)(H4,21,22,24);2*1H |
| Molecular Formula | C18H26N10O3 |
| Molar Mass | 430.46 |
| Density | 1.3374 (rough estimate) |
| Melting Point | 171-173℃ |
| Boling Point | 544.74°C (rough estimate) |
| Flash Point | 413.7°C |
| Solubility | H2O: 1mg/mL |
| Vapor Presure | 1.75E-23mmHg at 25°C |
| Appearance | powder |
| Color | faint yellow |
| pKa | 14.37±0.70(Predicted) |
| Storage Condition | −20°C |
| Sensitive | Sensitive to light |
| Refractive Index | 1.6500 (estimate) |
| MDL | MFCD00144883 |
| Physical and Chemical Properties | Solubility: H2O: 1 mg/ml storage conditions:? 20℃ WGK Germany:3 RTECS:DW2973000 |
| Use | N-methylpyrrole oligopeptides bind to the AT-rich sequence of dsDNA, especially at small groove sites. In this way, it protects the region from DNase I and endonuclease cleavage, and also inhibits topoisomerase. Spinocin disrupts the cell division cycle, prolongs the G phase, and stops the division in the G phase. It has anti-bacterial, fungal, pyramidal, vaccinia virus, phage and other functions in medicine. |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | 36 - Wear suitable protective clothing. |
| UN IDs | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DW2973000 |
| Toxicity | LD50 oral in mouse: 300mg/kg |