| Name | 4-Chlorostyrene |
| Synonyms | CHLOROSTYRENE-4 P-CHLOROSTYRENE p-chloro-styren 4-Chlorostyrene styrene,p-chloro- Styrene, p-chloro- 1-Chloro-4-vinylbenzene 1-Chloro-4-ethenylbenzene benzene, 1-chloro-4-ethenyl- |
| CAS | 1073-67-2 |
| EINECS | 214-028-8 |
| InChI | InChI=1/C8H7Cl/c1-2-7-3-5-8(9)6-4-7/h2-6H,1H2 |
| Molecular Formula | C8H7Cl |
| Molar Mass | 138.59 |
| Density | 1.155g/mLat 25°C(lit.) |
| Melting Point | -16 °C |
| Boling Point | 192°C(lit.) |
| Flash Point | 140°F |
| Water Solubility | Immiscible with water. |
| Vapor Presure | 0.68 mm Hg ( 20 °C) |
| Appearance | Transparent colorless liquid |
| Specific Gravity | 1.155 |
| Color | Clear colorless to slightly yellow |
| BRN | 1098859 |
| Storage Condition | 2-8°C |
| Refractive Index | n20/D 1.565(lit.) |
| MDL | MFCD00000632 |
| Physical and Chemical Properties | Appearance transparent liquid density 1.155 melting point -16 ℃ boiling point 192 ℃ flash point 60 ℃ |
| Use | P-tert-butylcatechol as stabilizer |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | 1993 |
| WGK Germany | 3 |
| RTECS | CZ0533000 |
| TSCA | T |
| HS Code | 29036990 |
| Hazard Class | 3 |
| Packing Group | III |
| Toxicity | LD50 orally in Rabbit: 5200 mg/kg |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| properties | 4-Chlorostyrene, also known as 4-Chlorostyrene, has a molecular formula of C8H7Cl, a molecular weight of 138.59, a CAS number of 1073-67-2, a boiling point of 192 oC, a density of 1.155g/cm3, and a colorless or light yellow liquid. Since the side chain is a C = C double bond, the chemical properties are more active. The compound can be slowly polymerized at room temperature, and a polymerization inhibitor (stabilizer) must be added to store it. |
| application | p-chlorophenylethene is a very important chemical raw material, and its derivatives can be applied to ion exchange resins, functional polymers, photosensitive polymers, polymer catalysts, medicines, pesticides, etc. It can also be made into Grignard reagent to synthesize polymerizable photoinitiators, which has broad market prospects. |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |